![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | books/ | 2023-07-28 22:53 | - | |
| datasheets/ | 2023-07-28 22:48 | - | |
| DM602-5 review_files/ | 2023-01-27 20:33 | - | |
| DM602s3 review 2_files/ | 2013-02-10 21:36 | - | |
| DM603S3 review_files/ | 2013-02-10 21:36 | - | |
| Encyclopedia Britannica 191..> | 2022-02-08 00:26 | - | |
| grey_imports/ | 2022-04-20 23:01 | - | |
| Manuals/ | 2023-09-16 20:37 | - | |
| Music/ | 2023-01-27 20:32 | - | |
| ross_auction/ | 2022-04-24 22:54 | - | |
| telecommunications/ | 2023-01-27 21:04 | - | |
| the-world-book-encyclopedia/ | 2022-04-25 00:17 | - | |
| UWA/ | 2023-07-28 22:52 | - | |
| Web PDF Crawl/ | 2024-03-15 16:01 | - | |
| Windows CE/ | 2022-04-20 23:34 | - | |
| www.bitsavers.org/ | 2023-03-26 14:06 | - | |
![[ ]](/icons/layout.gif) | 006.October 2011.pdf | 2016-06-12 21:06 | 6.4M | |
| 1201.pdf | 2017-10-20 22:25 | 255K | |
| 155.pdf | 2019-03-11 21:24 | 217K | |
| 1998 TDK SA 90 Audio Casset..> | 2019-01-27 17:56 | 195K | |
| 2004-00-00 Whitlams with WA..> | 2012-04-03 15:02 | 332K | |
| 2018-HILDA-SR-for-web.pdf | 2018-08-02 07:03 | 8.1M | |
| 2019q1.pdf | 2020-01-17 19:40 | 6.7M | |
| 2102.pdf | 2021-02-05 09:58 | 277K | |
| 211124_JCG972_John-Curtin-G..> | 2022-05-08 15:08 | 1.4M | |
| 3Dfx_VOODOO2_Revision_1.16_..> | 2023-03-20 23:00 | 1.8M | |
| 54b7f9bf8681400300255cab_or..> | 2022-06-21 17:33 | 2.2M | |
![[IMG]](/icons/image2.gif) | 5a9be2f71cf91c34.png | 2023-05-05 12:35 | 441K | |
| 625.pdf | 2017-12-18 21:33 | 4.3M | |
| 88EBF8B6-9733-4181-80E5-F93..> | 2015-11-12 07:58 | 254K | |
| 97405900C_PLATO_Users_Guide..> | 2023-03-19 23:20 | 14M | |
| A10_InfoSheet.pdf | 2019-04-04 22:10 | 960K | |
| A31008-M2230-R601-2-TE19_en..> | 2022-01-22 13:42 | 2.1M | |
| adbis96-P171.pdf | 2002-08-27 20:49 | 117K | |
| Adjusting Video Images.pdf | 2003-07-09 13:40 | 117K | |
| Alternative_Security_Proof_..> | 2021-08-08 20:30 | 535K | |
| apple_mac_os_x_technology.pdf | 2007-04-02 12:34 | 2.7M | |
| arachnet_domain_form.pdf | 2004-07-03 16:26 | 124K | |
| asx_trade_new_order_types.pdf | 2021-05-31 08:13 | 1.1M | |
| AT50_RECAP.pdf | 2022-03-06 18:58 | 5.6M | |
| AT7_First_Word.pdf | 2022-03-06 19:00 | 11M | |
| AT_Command_Set_For_Nokia_GS..> | 2004-04-02 23:18 | 3.0M | |
| AT_Command_Set_for_Nokia_TD..> | 2003-10-30 00:35 | 1.1M | |
| at_CYC_map_PerthFremantle-S..> | 2017-10-23 07:07 | 5.8M | |
| backpropogation.pdf | 2013-02-10 21:29 | 2.2M | |
| becs_procedure_public_2020.pdf | 2021-12-24 12:21 | 1.7M | |
| beos_programming_ch01.pdf | 2022-04-24 22:20 | 476K | BeOS Operating System and Software |
![[TXT]](/icons/text.gif) | bowers_wilkins_dm602.5_revi..> | 2005-11-10 21:52 | 6.6K | |
| bowers_wilkins_dm602s3_revi..> | 2005-11-10 21:53 | 5.3K | |
| bowers_wilkins_dm603s3 revi..> | 2005-11-10 21:47 | 51K | |
| Breaking WEP.htm | 2004-01-15 21:39 | 25K | |
| budget_overview_2003.pdf | 2004-05-11 22:59 | 561K | |
| budget_overview_2004.pdf | 2004-05-11 22:54 | 190K | |
| bumping.pdf | 2006-05-07 12:45 | 544K | |
| Bundesarchiv_Bild_183-1990-..> | 2021-03-11 20:12 | 62K | |
| burining_cds_linux.pdf | 2004-03-26 09:03 | 305K | |
| c_tutorial.pdf | 2003-11-15 00:09 | 1.4M | |
| CDMA FAQ Glossary.htm | 2003-12-12 12:48 | 32K | |
| CDMA Technical Information...> | 2003-09-28 11:34 | 22K | |
| cdrGoldUltima.pdf | 2022-01-22 23:05 | 115K | |
| CDRTools macos README.txt | 2022-11-15 21:02 | 3.3K | Text file |
| CEC_Specs.pdf | 2020-11-02 12:58 | 401K | |
| CheatSheet.pdf | 2016-05-16 20:12 | 147K | |
| clipsal_750_series_pir_om.pdf | 2018-04-24 06:27 | 290K | |
| clipsal_saturn_collection_b..> | 2018-05-05 22:19 | 3.3M | |
| cryptokey_forensics.pdf | 2016-07-10 22:45 | 150K | |
| CSAM_Detection_Technical_Su..> | 2021-08-08 20:29 | 1.9M | |
| D510MO_TechProdSpec02 copy.pdf | 2019-05-10 19:55 | 2.6M | |
| D510MO_TechProdSpec02.pdf | 2019-04-28 19:34 | 2.6M | |
| DAMRebook.pdf | 2005-10-14 08:35 | 32M | |
| dennis_ritchie_streams.pdf | 2020-09-16 23:51 | 34K | |
| Digital vs Analog Modulatio..> | 2019-03-16 20:07 | 2.7M | |
| Digital+Performer+User+Guid..> | 2019-06-14 14:48 | 37M | |
| digital_audio_compression_1..> | 2013-02-10 21:29 | 86K | |
![[ ]](/icons/unknown.gif) | dijkstra_ewd123.PDF | 2013-02-10 18:20 | 1.7M | |
| dijkstra_ewd678.pdf | 2007-08-29 09:44 | 37K | |
| DOC _0016.jpg | 2012-02-25 12:32 | 2.2M | |
| Dolby-Metadata-Guide.pdf | 2018-01-30 20:30 | 130K | |
| dolby_pro_logic.pdf | 2003-07-09 21:57 | 117K | |
| dp01fxcd_eng.pdf | 2022-11-05 16:19 | 6.5M | |
| DR_AR006EF_03--ARYG12-54LHT..> | 2018-07-05 23:19 | 22M | |
| EBA 2016 WEB.pdf | 2017-11-01 20:33 | 1.9M | |
| ECO_Insights_091120-CommSec..> | 2020-11-13 20:10 | 5.9M | |
![[ ]](/icons/compressed.gif) | encyclopaedia-britannica-en..> | 2022-02-03 11:54 | 821M | |
| encyclopaedia-britannica-en..> | 2022-02-11 13:38 | 821M | |
| encyclopaedia-britannica-en..> | 2022-02-03 10:42 | 29M | |
| encyclopaediabri28chisrich.pdf | 2022-02-11 20:37 | 110M | |
| Even&Sutherland-PS390.pdf | 2023-03-20 23:03 | 1.7M | |
| file_hierarchy_standard_2.3..> | 2004-12-01 19:27 | 499K | |
| fj_im_aryg60lhta_9380441038..> | 2018-07-06 13:47 | 6.4M | |
| fm_theory_and_applications.pdf | 2015-10-08 14:31 | 18M | |
| FRINGEWORLD 2018 _ CACTUS A..> | 2018-02-19 12:48 | 443K | |
| FRINGEWORLD 2018 _ CACTUS A..> | 2018-02-19 12:48 | 443K | |
| FRINGEWORLD 2018 _ Laser Ki..> | 2018-02-19 12:49 | 222K | |
| Fujitsu Service Manual.pdf | 2022-12-09 13:13 | 1.3M | |
| future_music_buying_guide_2..> | 2001-03-02 23:57 | 372K | |
| GPRS_Tutorial.pdf | 2004-10-22 12:37 | 101K | |
| harris_seminconductor_cd405..> | 2020-10-23 19:49 | 1.3M | |
| haskell-98-tutorial.pdf | 2009-03-28 12:50 | 836K | |
| hilbert.pdf | 2003-07-14 21:36 | 507K | |
| How many Reg columnists doe..> | 2019-03-16 09:46 | 1.8M | |
| hp_38g_serial_cable_wiring.txt | 2010-07-20 21:56 | 408 | Text file |
| httpsweb.stanford.edu~sujas..> | 2021-05-01 19:40 | 232K | |
| httpswww.espressif.comsites..> | 2021-05-19 12:42 | 1.5M | |
| Ians top ten best PSVR game..> | 2018-12-26 11:38 | 2.1M | |
| IMG_1476.heic | 2024-01-08 21:33 | 2.0M | |
| IMG_1476.jpg | 2024-01-08 22:25 | 87K | |
| In Defense of the CD Rollin..> | 2019-04-03 21:57 | 4.4M | |
| inx.pdf | 2022-04-24 22:22 | 54K | |
| JUNO-DS_88_76_61_ParamGuide..> | 2022-12-05 17:42 | 7.2M | |
| knuth_article_3442377.pdf | 2021-01-27 12:20 | 1.4M | |
| Korg microKorg DWGS Wavefor..> | 2022-11-04 11:08 | 4.9M | |
| kosmic_mtc.pdf | 2015-10-08 15:29 | 1.5M | |
| kosmic_pa.pdf | 2015-10-08 15:33 | 1.5M | |
| KRONOS_Update_3_0_3.zip | 2023-03-26 14:37 | 198M | |
| kt_reface_en_de_fr_es_pt_ru..> | 2019-06-14 14:48 | 2.8M | |
| language_models_are_few_sho..> | 2020-11-05 23:47 | 6.5M | |
| LBU_DL_B_RideSafe_e.pdf | 2022-03-08 00:13 | 9.7M | |
| Legends of The Wall, Part 4..> | 2013-02-10 21:16 | 50K | |
| Liger-Belair2017_Article_Ef..> | 2019-01-01 09:14 | 29M | |
| Linux Program Library HOWTO..> | 2006-08-21 16:07 | 71K | |
| Logic Programming with Prol..> | 2014-03-18 22:19 | 1.3M | |
| math4ml.pdf | 2021-01-21 20:39 | 695K | |
| MattiasEriksson.pdf | 2006-06-12 13:11 | 1.6M | |
| microsoft_windows_ce_faq.html | 2004-07-23 12:14 | 56K | |
| minidiscs.pdf | 2019-10-11 16:30 | 98K | |
| mit_artificial_intelligence..> | 2018-08-03 21:52 | 1.7M | |
| modern_3d_programming.pdf | 2021-04-12 19:59 | 4.7M | |
| mt32_midi.txt | 2004-06-02 12:17 | 31K | Text file |
| mt32_params.htm | 2004-10-25 19:28 | 44K | |
| mt32_sysex.htm | 2006-11-22 18:19 | 33K | |
| Multi-Objective Portfolio O..> | 2021-07-11 09:53 | 788K | |
| MVCHEAT.TXT | 1996-12-14 10:23 | 7.2K | |
| nad_factory_reset_procedure..> | 2018-03-24 22:04 | 219K | |
| Natural Language Processing..> | 2021-07-23 20:19 | 5.2M | |
| News announcements_ Industr..> | 2019-05-20 11:05 | 215K | |
| nokia_6385_data_suite_um.pdf | 2003-10-01 12:45 | 1.8M | |
| nokia_9300_um.pdf | 2005-01-13 19:25 | 3.9M | |
| nokia_field_test_tn.doc | 2003-12-12 13:18 | 156K | |
| nokia_smart_messaging.pdf | 2003-10-30 00:27 | 304K | |
| Oasys_Tutorial_Guide_633686..> | 2022-05-28 20:33 | 593K | |
| omen_bbs_perth_games_listin..> | 1996-12-14 10:39 | 37K | Text file |
| on_stage_mx400.pdf | 2019-12-26 19:32 | 258K | |
| OP1_reverse_enginering_MRMC..> | 2019-04-14 17:36 | 23M | |
| opensuse111_reference.pdf | 2010-04-23 20:01 | 4.2M | |
| oracle_nlp_feature_preparat..> | 2010-07-09 20:15 | 76K | |
| orinoco_router_reset_tn.pdf | 2006-11-28 15:33 | 136K | |
| Packing and storing books_0..> | 2022-05-06 10:38 | 83K | |
| page1.jpg | 2014-10-31 14:27 | 370K | |
| page2.jpg | 2014-10-31 14:27 | 833K | |
| page3.jpg | 2014-10-31 14:28 | 966K | |
| panasonic_dmr-bwt460gn_dmr-..> | 2024-10-07 08:13 | 9.7M | |
| parnass_faq.html | 1997-12-15 12:51 | 24K | |
| Path_COVID_19_CE_IVD_IFU_Is..> | 2022-05-04 23:21 | 587K | |
| path_covid_19_ce_sted_ifu_i..> | 2022-05-04 23:26 | 894K | |
| PDP 11 Handbook 1969.pdf | 2023-01-29 21:21 | 5.8M | |
| pink_floyd_cd_discography.pdf | 2018-03-16 15:55 | 819K | |
| pink_floyd_lighting.htm | 2006-11-06 17:32 | 23K | |
| Police Computer Forensic An..> | 2004-08-27 11:49 | 678K | |
| pr14521.pdf | 2022-04-25 20:12 | 328K | |
| Practical_Foundations_for_P..> | 2021-02-06 21:54 | 333K | |
| Punkt MP02 Internals.jpeg | 2022-11-07 18:21 | 1.8M | |
| qantas_domestic_eba_2008.pdf | 2013-02-10 21:30 | 1.3M | |
| qantas_international_eba_20..> | 2013-02-10 21:30 | 488K | |
| R-intro.pdf | 2017-11-12 19:18 | 614K | |
| Radiohead In Rainbows Al..> | 2021-06-10 22:28 | 1.0M | |
| Review On GSM Mobile Techno..> | 2003-09-30 19:58 | 90K | |
| ritchie84evolution.pdf | 2020-09-16 23:50 | 29K | |
| Roger Waters_ Us + Them - I..> | 2018-12-30 08:36 | 851K | |
| roland_jv80_reset.txt | 2011-07-11 08:54 | 933 | Text file |
| rolling_stones_top_500.txt | 2009-12-09 17:43 | 20K | Text file |
| Samba3-HOWTO.pdf | 2010-05-05 13:05 | 5.3M | |
| Setting up home cinema.html | 2000-10-06 08:47 | 13K | |
| SHOTGUN.pdf | 2014-10-19 14:06 | 100K | |
| Single-Ducted-Service-Instr..> | 2018-07-06 18:04 | 7.1M | |
| sony_dvcam_format_overview_..> | 2011-02-05 20:30 | 332K | |
| sony_vegas_hdv_workflow.pdf | 2013-02-10 21:29 | 1.5M | |
| Soundcraft_Signature_16-22_..> | 2017-09-12 05:52 | 11M | |
| sparc_linux_howto.html | 2004-08-18 23:07 | 5.5K | |
| spivey_z_notation_reference..> | 2011-10-12 14:24 | 42K | |
| st_john_codes.pdf | 2005-01-03 23:20 | 39K | |
| statistician_teachs_deep_le..> | 2021-02-05 09:58 | 277K | |
| stereo_mic_techniques.pdf | 2014-12-05 22:18 | 547K | |
| stereonet_audiofly_closure.pdf | 2021-08-10 21:16 | 3.7M | |
| Supreme Court of Queensland..> | 2007-08-28 20:02 | 423K | |
| SY34-0192-0_5120maint_Dec79..> | 2023-03-19 23:23 | 11M | |
| sysadmin_guide.pdf | 2010-11-02 16:31 | 365K | |
| T-758-AV-Surround-Sound-Rec..> | 2018-01-17 21:00 | 5.3M | |
| tascam_fw_1884_schematic_20..> | 2016-06-12 21:06 | 1.1M | |
| Taxpack-2002.pdf | 2022-12-03 02:09 | 1.5M | |
| Telethon Kids Institute mod..> | 2022-05-06 16:01 | 1.2M | |
| Tetra_Manual_v.1.pdf | 2019-06-14 14:48 | 1.3M | |
| The Unix Time Sharing Syste..> | 2020-09-16 23:50 | 155K | |
| the-world-book-encyclopedia..> | 2022-02-03 22:01 | 86M | Text file |
| the_hackers_hardware_toolki..> | 2021-04-12 19:52 | 11M | |
| The_Parallel_Enumeration_So..> | 2021-08-25 09:23 | 837K | |
| thinking-forth-kindle.pdf | 2022-11-20 20:24 | 6.2M | |
| thinking-forth.pdf | 2022-11-20 20:24 | 4.3M | |
| Trading in the Australian S..> | 2012-04-16 14:40 | 1.0M | |
| trunkline-q2-2021.pdf | 2022-12-03 02:00 | 7.0M | |
| trunkline-q3-2021.pdf | 2022-12-03 01:58 | 7.0M | |
| udf250.pdf | 2022-11-18 22:01 | 695K | |
| udf260.pdf | 2022-11-18 21:59 | 808K | |
| understanding_ipv6_1997.pdf | 2004-07-01 11:42 | 144K | |
| unix_hacking_1997.txt | 2004-10-26 01:48 | 525K | Text file |
| unix_prog_design.pdf | 2020-09-16 23:50 | 26K | |
| Untitled 1.pdf | 2021-01-02 14:39 | 1.4M | |
| Untitled 2.pdf | 2021-01-14 22:31 | 802K | |
| Untitled 4.pdf | 2021-02-11 21:18 | 10M | |
| Untitled.pdf | 2020-12-27 23:41 | 1.6M | |
| URL vuln.htm | 2003-12-12 10:07 | 15K | |
| urwid.pdf | 2021-07-18 16:45 | 98K | |
| usb_audio_and_windows.doc | 2005-07-08 02:57 | 131K | |
| user-guide-libra-user-guide..> | 2022-10-22 00:14 | 250K | |
| Using EMACS.htm | 2003-10-17 23:57 | 16K | |
| Using MIDI to Select Patche..> | 2018-12-20 00:24 | 178K | |
| UTY-RNBYU_IM.pdf | 2023-02-16 11:03 | 264K | |
| vax_vms_on_linux.pdf | 2012-06-02 11:32 | 507K | |
| Viridian Glass Performance ..> | 2017-11-14 10:29 | 103K | |
| Wave Format Information.htm | 2000-12-30 02:44 | 4.3K | |
| wavelet_tutorial [2003].doc | 2003-07-15 13:01 | 855K | |
| WEP_Lucent.pdf | 2000-09-25 22:45 | 136K | |
| what's inside Yamaha DX7 _ ..> | 2019-03-16 19:58 | 1.5M | |
| WHP034_ADD23-Sony-HVR-V1.pdf | 2013-02-10 21:30 | 114K | |
| windows_ce_evt_development_..> | 2003-10-17 20:31 | 23K | |
| windows_ce_networking_1998.htm | 2003-08-01 21:27 | 78K | |
| yamaha_qy70_faq.pdf | 2018-11-22 20:02 | 114K | |
|
|---|
![[IMG]](5a9be2f71cf91c34.png){kind=small}
![[IMG]](88EBF8B6-9733-4181-80E5-F934626AA407.png){kind=small}
![[IMG]](Bundesarchiv_Bild_183-1990-0722-402,_Berlin,_Auff%c3%bchrung_der_Rockoper_%ef%80%a0The_Wall%ef%80%a0.jpg){kind=small}
![[IMG]](DOC%20_0016.jpg){kind=small}
![[ ]](IMG_1476.heic){kind=small}
![[IMG]](IMG_1476.jpg){kind=small}
![[IMG]](page1.jpg){kind=small}
![[IMG]](page2.jpg){kind=small}
![[IMG]](page3.jpg){kind=small}
![[IMG]](Punkt%20MP02%20Internals.jpeg){kind=small}