Legends of The Wall, Part 4 Lighting_files
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[DIR]](/icons/folder.gif){kind=icon} | def_data/ | 2013-02-10 21:16 | - | |
| reply_data/ | 2013-02-10 21:16 | - | |
| upload_data/ | 2013-02-10 21:16 | - | |
![[IMG]](4-ExcelAwards728x90.gif){kind=small} | 4-ExcelAwards728x90.gif | 2012-01-30 09:03 | 15K | |
![[IMG]](4-ExcelAwards_180x150.gif){kind=small} | 4-ExcelAwards_180x150.gif | 2012-01-30 09:03 | 9.1K | |
![[IMG]](636-12SEP10-126.jpg){kind=small} | 636-12SEP10-126.jpg | 2012-02-20 21:09 | 28K | |
![[IMG]](636-16SEP10-259.jpg){kind=small} | 636-16SEP10-259.jpg | 2012-02-20 21:09 | 22K | |
![[IMG]](817-grey.gif){kind=small} | 817-grey.gif | 2012-01-30 09:03 | 43 | |
![[ ]](/icons/unknown.gif){kind=icon} | addthis_widget.js | 2012-01-30 09:03 | 62K | |
| adtarget.js | 2012-01-30 09:03 | 262 | |
| adtarget_002.js | 2012-01-30 09:03 | 340 | |
| adtarget_003.js | 2012-01-30 09:03 | 375 | |
| adtarget_004.js | 2012-01-30 09:03 | 378 | |
| button.js | 2012-01-30 09:03 | 11K | |
| cookieCheck.js | 2012-01-30 09:03 | 1.1K | |
![[TXT]](/icons/text.gif){kind=icon} | def.htm | 2012-01-30 09:03 | 28K | |
| defaults.css | 2012-01-30 09:03 | 50K | |
| demandbase_call.js | 2012-01-30 09:03 | 899 | |
| disqus.js | 2012-01-30 09:03 | 179K | |
| embed.js | 2012-01-30 09:03 | 37K | |
| heds.js | 2012-01-30 09:03 | 850 | |
| initialize.css | 2012-01-30 09:03 | 4.3K | |
| ip.json | 2012-01-30 09:03 | 226 | |
| jquery-cookie.js | 2012-01-30 09:03 | 4.2K | |
| latest-jquery.js | 2012-01-30 09:03 | 54K | |
| new_style.css | 2012-01-30 09:03 | 39K | |
![[IMG]](noavatar92.png){kind=avatar} | noavatar92.png | 2012-02-20 21:09 | 5.6K | |
| osd.js | 2012-01-30 09:03 | 12K | |
![[IMG]](PIF300.jpg){kind=small} | PIF300.jpg | 2012-02-20 21:09 | 20K | |
| print.css | 2012-01-30 09:03 | 914 | |
![[IMG]](printLogo.gif){kind=small} | printLogo.gif | 2012-01-30 09:03 | 13K | |
| reply.htm | 2012-01-30 09:03 | 33K | |
![[IMG]](reply.png){kind=small} | reply.png | 2012-02-20 21:09 | 1.3K | |
| roadblock.css | 2012-01-30 09:03 | 1.2K | |
| s_code.js | 2012-01-30 09:03 | 50K | |
![[IMG]](SeaChanger_ad.jpg){kind=small} | SeaChanger_ad.jpg | 2012-02-20 21:09 | 18K | |
| sh72.htm | 2012-01-30 09:03 | 40K | |
| show_ads.js | 2012-01-30 09:03 | 11K | |
| show_ads_impl.js | 2012-01-30 09:03 | 48K | |
| slf.js | 2012-01-30 09:03 | 9.3K | |
| structure.css | 2012-01-30 09:03 | 590 | |
| tabbing.js | 2012-01-30 09:03 | 2.8K | |
| theme.css | 2012-01-30 09:03 | 14K | |
| theme.js | 2012-01-30 09:03 | 37K | |
| thread.js | 2012-01-30 09:03 | 12K | |
| tools.js | 2012-01-30 09:03 | 4.2K | |
| upload.htm | 2012-01-30 09:03 | 14K | |
| widget75.css | 2012-01-30 09:03 | 37K | |